C16H16F3N3O5S — CID 168620674
2-[2-[[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620674) has the molecular formula C16H16F3N3O5S and a molecular weight of 419.38 g/mol. Its IUPAC name is 2-[2-[[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620674 |
| Molecular Formula | C16H16F3N3O5S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-[2-[[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1ccc(C=NN=C2NC(=O)C(CC(=O)O)S2)cc1COCC(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O5S/c1-26-11-3-2-9(4-10(11)7-27-8-16(17,18)19)6-20-22-15-21-14(25)12(28-15)5-13(23)24/h2-4,6,12H,5,7-8H2,1H3,(H,23,24)(H,21,22,25) |
| InChIKey | UYMCKCUFEOLKOM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|