C20H17Cl2N3O5S — CID 168621423
2-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621423) has the molecular formula C20H17Cl2N3O5S and a molecular weight of 482.35 g/mol. Its IUPAC name is 2-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621423 |
| Molecular Formula | C20H17Cl2N3O5S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 2-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O5S/c1-29-16-6-11(9-23-25-20-24-19(28)17(31-20)8-18(26)27)2-5-15(16)30-10-12-3-4-13(21)7-14(12)22/h2-7,9,17H,8,10H2,1H3,(H,26,27)(H,24,25,28) |
| InChIKey | VDGKYFBOBGNOET-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|