C19H19BrO3 — CID 19541346
(E)-1-(4-bromophenyl)-3-[3-(ethoxymethyl)-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19541346) has the molecular formula C19H19BrO3 and a molecular weight of 375.26 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-[3-(ethoxymethyl)-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-[3-(ethoxymethyl)-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19541346 |
| Molecular Formula | C19H19BrO3 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-[3-(ethoxymethyl)-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | CCOCc1cc(/C=C/C(=O)c2ccc(Br)cc2)ccc1OC |
| InChI | InChI=1S/C19H19BrO3/c1-3-23-13-16-12-14(5-11-19(16)22-2)4-10-18(21)15-6-8-17(20)9-7-15/h4-12H,3,13H2,1-2H3/b10-4+ |
| InChIKey | DZMAYZRJTCGVEF-ONNFQVAWSA-N |
| XLogP | 4.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|