C10H16OS — CID 145366912
1-(2,5-dimethylthiophen-3-yl)butan-2-ol (PubChem CID 145366912) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)butan-2-ol.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)butan-2-ol |
|---|---|
| PubChem CID | 145366912 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)butan-2-ol |
| SMILES | CCC(O)Cc1cc(C)sc1C |
| InChI | InChI=1S/C10H16OS/c1-4-10(11)6-9-5-7(2)12-8(9)3/h5,10-11H,4,6H2,1-3H3 |
| InChIKey | LHIHRDZQZSPMRJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |