C13H23NS — CID 115887531
N-[2-(2,5-dimethylthiophen-3-yl)ethyl]-2-methylbutan-1-amine (PubChem CID 115887531) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is N-[2-(2,5-dimethylthiophen-3-yl)ethyl]-2-methylbutan-1-amine.
| Compound Name | N-[2-(2,5-dimethylthiophen-3-yl)ethyl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 115887531 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N-[2-(2,5-dimethylthiophen-3-yl)ethyl]-2-methylbutan-1-amine |
| SMILES | CCC(C)CNCCc1cc(C)sc1C |
| InChI | InChI=1S/C13H23NS/c1-5-10(2)9-14-7-6-13-8-11(3)15-12(13)4/h8,10,14H,5-7,9H2,1-4H3 |
| InChIKey | VRUKIMASEWPHBG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|