C11H19NS — CID 64865985
N-[2-(2,5-dimethylthiophen-3-yl)ethyl]propan-1-amine (PubChem CID 64865985) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is N-[2-(2,5-dimethylthiophen-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2,5-dimethylthiophen-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64865985 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-[2-(2,5-dimethylthiophen-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNCCc1cc(C)sc1C |
| InChI | InChI=1S/C11H19NS/c1-4-6-12-7-5-11-8-9(2)13-10(11)3/h8,12H,4-7H2,1-3H3 |
| InChIKey | GOKHBVUPTDNMNP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|