C8H12N2O — CID 82490394
2-(2,5-dimethyl-1H-pyrrol-3-yl)acetamide (PubChem CID 82490394) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1H-pyrrol-3-yl)acetamide.
| Compound Name | 2-(2,5-dimethyl-1H-pyrrol-3-yl)acetamide |
|---|---|
| PubChem CID | 82490394 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-(2,5-dimethyl-1H-pyrrol-3-yl)acetamide |
| SMILES | Cc1cc(CC(N)=O)c(C)[nH]1 |
| InChI | InChI=1S/C8H12N2O/c1-5-3-7(4-8(9)11)6(2)10-5/h3,10H,4H2,1-2H3,(H2,9,11) |
| InChIKey | ULOMTCXMMFUIEE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |