C7H11N — CID 16620
2,3,5-trimethyl-1H-pyrrole (PubChem CID 16620) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 2,3,5-trimethyl-1H-pyrrole.
| Compound Name | 2,3,5-trimethyl-1H-pyrrole |
|---|---|
| PubChem CID | 16620 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2,3,5-trimethyl-1H-pyrrole |
| SMILES | Cc1cc(C)c(C)[nH]1 |
| InChI | InChI=1S/C7H11N/c1-5-4-6(2)8-7(5)3/h4,8H,1-3H3 |
| InChIKey | VIDOWPWTFHJVID-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |