C8H11NO — CID 2798358
1-(3,5-dimethyl-1H-pyrrol-2-yl)ethanone (PubChem CID 2798358) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrrol-2-yl)ethanone.
| Compound Name | 1-(3,5-dimethyl-1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 2798358 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrrol-2-yl)ethanone |
| SMILES | CC(=O)c1[nH]c(C)cc1C |
| InChI | InChI=1S/C8H11NO/c1-5-4-6(2)9-8(5)7(3)10/h4,9H,1-3H3 |
| InChIKey | KSZNMNSPWOIFPE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |