C10H15NO — CID 653478
1-(5-ethyl-2,4-dimethyl-1H-pyrrol-3-yl)ethanone (PubChem CID 653478) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-(5-ethyl-2,4-dimethyl-1H-pyrrol-3-yl)ethanone.
| Compound Name | 1-(5-ethyl-2,4-dimethyl-1H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 653478 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1-(5-ethyl-2,4-dimethyl-1H-pyrrol-3-yl)ethanone |
| SMILES | CCc1[nH]c(C)c(C(C)=O)c1C |
| InChI | InChI=1S/C10H15NO/c1-5-9-6(2)10(8(4)12)7(3)11-9/h11H,5H2,1-4H3 |
| InChIKey | USXUHJDVFUTRSC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |