About 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde
3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde (PubChem CID 3599076) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde |
| PubChem CID | 3599076 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde |
| SMILES | Cc1c(C=O)[nH]c(C=O)c1C |
| InChI | InChI=1S/C8H9NO2/c1-5-6(2)8(4-11)9-7(5)3-10/h3-4,9H,1-2H3 |
| InChIKey | OBJSCIPKJZMQMD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde?
The IUPAC name of 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde (CID 3599076) is 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde.
What is the SMILES notation for 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde?
The canonical SMILES for 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde is Cc1c(C=O)[nH]c(C=O)c1C.
What is the InChIKey of 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde?
The InChIKey is OBJSCIPKJZMQMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-5-6(2)8(4-11)9-7(5)3-10/h3-4,9H,1-2H3.
What are the key properties of 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde?
3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde has a molecular weight of 151.16 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde is sourced from PubChem (CID 3599076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).