C8H9NO2 — CID 3599076
3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde (PubChem CID 3599076) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde.
| Compound Name | 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde |
|---|---|
| PubChem CID | 3599076 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3,4-dimethyl-1H-pyrrole-2,5-dicarbaldehyde |
| SMILES | Cc1c(C=O)[nH]c(C=O)c1C |
| InChI | InChI=1S/C8H9NO2/c1-5-6(2)8(4-11)9-7(5)3-10/h3-4,9H,1-2H3 |
| InChIKey | OBJSCIPKJZMQMD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|