C12H19BrClN3OS — CID 102840263
2-(4-bromo-5-chlorothiophen-2-yl)-2-[2-(diethylamino)ethylamino]acetamide (PubChem CID 102840263) has the molecular formula C12H19BrClN3OS and a molecular weight of 368.73 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-2-[2-(diethylamino)ethylamino]acetamide.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-[2-(diethylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 102840263 |
| Molecular Formula | C12H19BrClN3OS |
| Molecular Weight | 368.73 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-[2-(diethylamino)ethylamino]acetamide |
| SMILES | CCN(CC)CCNC(C(N)=O)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C12H19BrClN3OS/c1-3-17(4-2)6-5-16-10(12(15)18)9-7-8(13)11(14)19-9/h7,10,16H,3-6H2,1-2H3,(H2,15,18) |
| InChIKey | FRBIWZWRYPQLMP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |