C15H24BrN3O2 — CID 61036831
2-(3-bromo-4-methoxyphenyl)-2-[2-(diethylamino)ethylamino]acetamide (PubChem CID 61036831) has the molecular formula C15H24BrN3O2 and a molecular weight of 358.28 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-2-[2-(diethylamino)ethylamino]acetamide.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-2-[2-(diethylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 61036831 |
| Molecular Formula | C15H24BrN3O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-2-[2-(diethylamino)ethylamino]acetamide |
| SMILES | CCN(CC)CCNC(C(N)=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C15H24BrN3O2/c1-4-19(5-2)9-8-18-14(15(17)20)11-6-7-13(21-3)12(16)10-11/h6-7,10,14,18H,4-5,8-9H2,1-3H3,(H2,17,20) |
| InChIKey | RHFJFHVUYFIQKB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |