C13H20BrN3O — CID 105401809
2-(3-bromo-4-methylphenyl)-2-[2-(dimethylamino)ethylamino]acetamide (PubChem CID 105401809) has the molecular formula C13H20BrN3O and a molecular weight of 314.23 g/mol. Its IUPAC name is 2-(3-bromo-4-methylphenyl)-2-[2-(dimethylamino)ethylamino]acetamide.
| Compound Name | 2-(3-bromo-4-methylphenyl)-2-[2-(dimethylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 105401809 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-(3-bromo-4-methylphenyl)-2-[2-(dimethylamino)ethylamino]acetamide |
| SMILES | Cc1ccc(C(NCCN(C)C)C(N)=O)cc1Br |
| InChI | InChI=1S/C13H20BrN3O/c1-9-4-5-10(8-11(9)14)12(13(15)18)16-6-7-17(2)3/h4-5,8,12,16H,6-7H2,1-3H3,(H2,15,18) |
| InChIKey | GEZFFBNHUCJFRR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |