C12H16F3N3O — CID 63076271
2-[2-(dimethylamino)ethylamino]-2-(3,4,5-trifluorophenyl)acetamide (PubChem CID 63076271) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-2-(3,4,5-trifluorophenyl)acetamide.
| Compound Name | 2-[2-(dimethylamino)ethylamino]-2-(3,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 63076271 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[2-(dimethylamino)ethylamino]-2-(3,4,5-trifluorophenyl)acetamide |
| SMILES | CN(C)CCNC(C(N)=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H16F3N3O/c1-18(2)4-3-17-11(12(16)19)7-5-8(13)10(15)9(14)6-7/h5-6,11,17H,3-4H2,1-2H3,(H2,16,19) |
| InChIKey | CCNCSCKXUDCFON-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|