C14H21BrClN3O — CID 83230961
2-(3-bromo-4-chlorophenyl)-2-[2-(diethylamino)ethylamino]acetamide (PubChem CID 83230961) has the molecular formula C14H21BrClN3O and a molecular weight of 362.70 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-2-[2-(diethylamino)ethylamino]acetamide.
| Compound Name | 2-(3-bromo-4-chlorophenyl)-2-[2-(diethylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 83230961 |
| Molecular Formula | C14H21BrClN3O |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-2-[2-(diethylamino)ethylamino]acetamide |
| SMILES | CCN(CC)CCNC(C(N)=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H21BrClN3O/c1-3-19(4-2)8-7-18-13(14(17)20)10-5-6-12(16)11(15)9-10/h5-6,9,13,18H,3-4,7-8H2,1-2H3,(H2,17,20) |
| InChIKey | MGJNADDEBLPRLN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |