C11H13BrClNO3 — CID 83229877
2-(3-bromo-4-chlorophenyl)-2-(2-methoxyethylamino)acetic acid (PubChem CID 83229877) has the molecular formula C11H13BrClNO3 and a molecular weight of 322.59 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-2-(2-methoxyethylamino)acetic acid.
| Compound Name | 2-(3-bromo-4-chlorophenyl)-2-(2-methoxyethylamino)acetic acid |
|---|---|
| PubChem CID | 83229877 |
| Molecular Formula | C11H13BrClNO3 |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-2-(2-methoxyethylamino)acetic acid |
| SMILES | COCCNC(C(=O)O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C11H13BrClNO3/c1-17-5-4-14-10(11(15)16)7-2-3-9(13)8(12)6-7/h2-3,6,10,14H,4-5H2,1H3,(H,15,16) |
| InChIKey | RMHMUUIDRYYRIU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|