C10H14BrNO3S — CID 102841052
2-(4-bromo-5-methylthiophen-2-yl)-2-(2-methoxyethylamino)acetic acid (PubChem CID 102841052) has the molecular formula C10H14BrNO3S and a molecular weight of 308.20 g/mol. Its IUPAC name is 2-(4-bromo-5-methylthiophen-2-yl)-2-(2-methoxyethylamino)acetic acid.
| Compound Name | 2-(4-bromo-5-methylthiophen-2-yl)-2-(2-methoxyethylamino)acetic acid |
|---|---|
| PubChem CID | 102841052 |
| Molecular Formula | C10H14BrNO3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-(4-bromo-5-methylthiophen-2-yl)-2-(2-methoxyethylamino)acetic acid |
| SMILES | COCCNC(C(=O)O)c1cc(Br)c(C)s1 |
| InChI | InChI=1S/C10H14BrNO3S/c1-6-7(11)5-8(16-6)9(10(13)14)12-3-4-15-2/h5,9,12H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | BFJOGTDPJBLMPA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|