C10H17N3O3 — CID 79583704
2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid (PubChem CID 79583704) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid.
| Compound Name | 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid |
|---|---|
| PubChem CID | 79583704 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid |
| SMILES | COCCNC(C(=O)O)c1cnn(C)c1C |
| InChI | InChI=1S/C10H17N3O3/c1-7-8(6-12-13(7)2)9(10(14)15)11-4-5-16-3/h6,9,11H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | GRMDCXCPTGYALV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|