2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid

C10H17N3O3 — CID 79583704

IUPAC2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid
SMILESCOCCNC(C(=O)O)c1cnn(C)c1C
InChIInChI=1S/C10H17N3O3/c1-7-8(6-12-13(7)2)9(10(14)15)11-4-5-16-3/h6,9,11H,4-5H2,1-3H3,(H,14,15)
InChIKeyGRMDCXCPTGYALV-UHFFFAOYSA-N
MW227.26 g/mol
LogP0.09
Rot. Bonds6

About 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid

2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid (PubChem CID 79583704) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid.

Molecular Properties

Compound Name2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid
PubChem CID79583704
Molecular FormulaC10H17N3O3
Molecular Weight227.26 g/mol
Exact Mass227.13
IUPAC Name2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid
SMILESCOCCNC(C(=O)O)c1cnn(C)c1C
InChIInChI=1S/C10H17N3O3/c1-7-8(6-12-13(7)2)9(10(14)15)11-4-5-16-3/h6,9,11H,4-5H2,1-3H3,(H,14,15)
InChIKeyGRMDCXCPTGYALV-UHFFFAOYSA-N
XLogP0.09
TPSA76.38 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.26
LogP ≤ 50.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid?
The IUPAC name of 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid (CID 79583704) is 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid.
What is the SMILES notation for 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid?
The canonical SMILES for 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid is COCCNC(C(=O)O)c1cnn(C)c1C.
What is the InChIKey of 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid?
The InChIKey is GRMDCXCPTGYALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-7-8(6-12-13(7)2)9(10(14)15)11-4-5-16-3/h6,9,11H,4-5H2,1-3H3,(H,14,15).
What are the key properties of 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid?
2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid has a molecular weight of 227.26 g/mol, XLogP of 0.09, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyethylamino)acetic acid is sourced from PubChem (CID 79583704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).