C15H20N2O4 — CID 84748283
2-(2-methoxyethylamino)-2-(5-methoxy-1-methylindol-3-yl)acetic acid (PubChem CID 84748283) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-2-(5-methoxy-1-methylindol-3-yl)acetic acid.
| Compound Name | 2-(2-methoxyethylamino)-2-(5-methoxy-1-methylindol-3-yl)acetic acid |
|---|---|
| PubChem CID | 84748283 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-(2-methoxyethylamino)-2-(5-methoxy-1-methylindol-3-yl)acetic acid |
| SMILES | COCCNC(C(=O)O)c1cn(C)c2ccc(OC)cc12 |
| InChI | InChI=1S/C15H20N2O4/c1-17-9-12(14(15(18)19)16-6-7-20-2)11-8-10(21-3)4-5-13(11)17/h4-5,8-9,14,16H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | LWIROLVLQZILMJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|