C12H17N3O — CID 170894776
1-(5-methoxy-1-methylindol-3-yl)ethane-1,2-diamine (PubChem CID 170894776) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-(5-methoxy-1-methylindol-3-yl)ethane-1,2-diamine.
| Compound Name | 1-(5-methoxy-1-methylindol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 170894776 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-(5-methoxy-1-methylindol-3-yl)ethane-1,2-diamine |
| SMILES | COc1ccc2c(c1)c(C(N)CN)cn2C |
| InChI | InChI=1S/C12H17N3O/c1-15-7-10(11(14)6-13)9-5-8(16-2)3-4-12(9)15/h3-5,7,11H,6,13-14H2,1-2H3 |
| InChIKey | FOBLLGKGYUXGRX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |