C15H24N2O3 — CID 60993508
methyl 2-[2-(diethylamino)ethylamino]-2-(4-hydroxyphenyl)acetate (PubChem CID 60993508) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl 2-[2-(diethylamino)ethylamino]-2-(4-hydroxyphenyl)acetate.
| Compound Name | methyl 2-[2-(diethylamino)ethylamino]-2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 60993508 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | methyl 2-[2-(diethylamino)ethylamino]-2-(4-hydroxyphenyl)acetate |
| SMILES | CCN(CC)CCNC(C(=O)OC)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H24N2O3/c1-4-17(5-2)11-10-16-14(15(19)20-3)12-6-8-13(18)9-7-12/h6-9,14,16,18H,4-5,10-11H2,1-3H3 |
| InChIKey | NCTHUYLHFXOXLF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |