C24H36N2O2 — CID 110186176
1-adamantyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate (PubChem CID 110186176) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-adamantyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate.
| Compound Name | 1-adamantyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 110186176 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-adamantyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate |
| SMILES | CCN(CC)CCNC(C(=O)OC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C24H36N2O2/c1-3-26(4-2)11-10-25-22(21-8-6-5-7-9-21)23(27)28-24-15-18-12-19(16-24)14-20(13-18)17-24/h5-9,18-20,22,25H,3-4,10-17H2,1-2H3 |
| InChIKey | FKBLGRFOPBBHOU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |