C24H42N2O2 — CID 110186212
decan-4-yl 2-[2-(diethylamino)ethylamino]-2-phenylacetate (PubChem CID 110186212) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is decan-4-yl 2-[2-(diethylamino)ethylamino]-2-phenylacetate.
| Compound Name | decan-4-yl 2-[2-(diethylamino)ethylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 110186212 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | decan-4-yl 2-[2-(diethylamino)ethylamino]-2-phenylacetate |
| SMILES | CCCCCCC(CCC)OC(=O)C(NCCN(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C24H42N2O2/c1-5-9-10-14-18-22(15-6-2)28-24(27)23(21-16-12-11-13-17-21)25-19-20-26(7-3)8-4/h11-13,16-17,22-23,25H,5-10,14-15,18-20H2,1-4H3 |
| InChIKey | KGYHOTHGOLWSQK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|