C19H33NO3 — CID 155594508
N-methylmethanamine;octan-4-yl 3-hydroxy-2-phenylpropanoate (PubChem CID 155594508) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is N-methylmethanamine;octan-4-yl 3-hydroxy-2-phenylpropanoate.
| Compound Name | N-methylmethanamine;octan-4-yl 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 155594508 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | N-methylmethanamine;octan-4-yl 3-hydroxy-2-phenylpropanoate |
| SMILES | CCCCC(CCC)OC(=O)C(CO)c1ccccc1.CNC |
| InChI | InChI=1S/C17H26O3.C2H7N/c1-3-5-12-15(9-4-2)20-17(19)16(13-18)14-10-7-6-8-11-14;1-3-2/h6-8,10-11,15-16,18H,3-5,9,12-13H2,1-2H3;3H,1-2H3 |
| InChIKey | JBXJFSIKMAXPKO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |