About (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate
(3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate (PubChem CID 155594506) has the molecular formula C25H40O4S
and a molecular weight of 436.66 g/mol. Its IUPAC name is (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate.
Molecular Properties
| Compound Name | (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate |
| PubChem CID | 155594506 |
| Molecular Formula | C25H40O4S |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate |
| SMILES | CCCCC(CCC)OC(=O)C(COC(=O)CCCCC(S)CC)c1ccccc1 |
| InChI | InChI=1S/C25H40O4S/c1-4-7-16-21(13-5-2)29-25(27)23(20-14-9-8-10-15-20)19-28-24(26)18-12-11-17-22(30)6-3/h8-10,14-15,21-23,30H,4-7,11-13,16-19H2,1-3H3 |
| InChIKey | PVBWBGBOPAYFSB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate?
The IUPAC name of (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate (CID 155594506) is (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate.
What is the SMILES notation for (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate?
The canonical SMILES for (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate is CCCCC(CCC)OC(=O)C(COC(=O)CCCCC(S)CC)c1ccccc1.
What is the InChIKey of (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate?
The InChIKey is PVBWBGBOPAYFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40O4S/c1-4-7-16-21(13-5-2)29-25(27)23(20-14-9-8-10-15-20)19-28-24(26)18-12-11-17-22(30)6-3/h8-10,14-15,21-23,30H,4-7,11-13,16-19H2,1-3H3.
What are the key properties of (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate?
(3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate has a molecular weight of 436.66 g/mol, XLogP of 6.48, 16 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-octan-4-yloxy-3-oxo-2-phenylpropyl) 6-sulfanyloctanoate is sourced from PubChem (CID 155594506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).