About nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide
nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide (PubChem CID 162337971) has the molecular formula C18H35BrO6
and a molecular weight of 427.38 g/mol. Its IUPAC name is nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide.
Molecular Properties
| Compound Name | nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide |
| PubChem CID | 162337971 |
| Molecular Formula | C18H35BrO6 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide |
| SMILES | Br.CCCCCCC(CC)OC(=O)C(CO)c1ccccc1.O.O.O |
| InChI | InChI=1S/C18H28O3.BrH.3H2O/c1-3-5-6-10-13-16(4-2)21-18(20)17(14-19)15-11-8-7-9-12-15;;;;/h7-9,11-12,16-17,19H,3-6,10,13-14H2,1-2H3;1H;3*1H2 |
| InChIKey | RWYWHJGQOJJSRL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide?
The IUPAC name of nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide (CID 162337971) is nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide.
What is the SMILES notation for nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide?
The canonical SMILES for nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide is Br.CCCCCCC(CC)OC(=O)C(CO)c1ccccc1.O.O.O.
What is the InChIKey of nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide?
The InChIKey is RWYWHJGQOJJSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O3.BrH.3H2O/c1-3-5-6-10-13-16(4-2)21-18(20)17(14-19)15-11-8-7-9-12-15;;;;/h7-9,11-12,16-17,19H,3-6,10,13-14H2,1-2H3;1H;3*1H2.
What are the key properties of nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide?
nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide has a molecular weight of 427.38 g/mol, XLogP of 2.16, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-3-yl 3-hydroxy-2-phenylpropanoate;trihydrate;hydrobromide is sourced from PubChem (CID 162337971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).