C24H40O4 — CID 144624388
hexane;[(E)-1-hydroxy-2,6-dimethylhept-1-en-4-yl] 3-hydroxy-2-phenylpropanoate (PubChem CID 144624388) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is hexane;[(E)-1-hydroxy-2,6-dimethylhept-1-en-4-yl] 3-hydroxy-2-phenylpropanoate.
| Compound Name | hexane;[(E)-1-hydroxy-2,6-dimethylhept-1-en-4-yl] 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 144624388 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | hexane;[(E)-1-hydroxy-2,6-dimethylhept-1-en-4-yl] 3-hydroxy-2-phenylpropanoate |
| SMILES | C/C(=C\O)CC(CC(C)C)OC(=O)C(CO)c1ccccc1.CCCCCC |
| InChI | InChI=1S/C18H26O4.C6H14/c1-13(2)9-16(10-14(3)11-19)22-18(21)17(12-20)15-7-5-4-6-8-15;1-3-5-6-4-2/h4-8,11,13,16-17,19-20H,9-10,12H2,1-3H3;3-6H2,1-2H3/b14-11+; |
| InChIKey | XXCWAVSOHXIFPQ-JHGYPSGKSA-N |
| XLogP | 6.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|