C24H36O6 — CID 11154372
methyl (11S)-11-[(2S)-2-methoxy-2-phenylacetyl]oxy-4-oxotetradecanoate (PubChem CID 11154372) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is methyl (11S)-11-[(2S)-2-methoxy-2-phenylacetyl]oxy-4-oxotetradecanoate.
| Compound Name | methyl (11S)-11-[(2S)-2-methoxy-2-phenylacetyl]oxy-4-oxotetradecanoate |
|---|---|
| PubChem CID | 11154372 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | methyl (11S)-11-[(2S)-2-methoxy-2-phenylacetyl]oxy-4-oxotetradecanoate |
| SMILES | CCC[C@@H](CCCCCCC(=O)CCC(=O)OC)OC(=O)[C@@H](OC)c1ccccc1 |
| InChI | InChI=1S/C24H36O6/c1-4-12-21(30-24(27)23(29-3)19-13-8-7-9-14-19)16-11-6-5-10-15-20(25)17-18-22(26)28-2/h7-9,13-14,21,23H,4-6,10-12,15-18H2,1-3H3/t21-,23-/m0/s1 |
| InChIKey | IRWZGCXGVASNPI-GMAHTHKFSA-N |
| XLogP | 4.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|