About [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate
[(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate (PubChem CID 11418945) has the molecular formula C25H32O6
and a molecular weight of 428.53 g/mol. Its IUPAC name is [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate.
Molecular Properties
| Compound Name | [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate |
| PubChem CID | 11418945 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate |
| SMILES | CCCC[C@@H](OC(=O)[C@H](OC)c1ccccc1)[C@H](C)OC(=O)[C@H](OC)c1ccccc1 |
| InChI | InChI=1S/C25H32O6/c1-5-6-17-21(31-25(27)23(29-4)20-15-11-8-12-16-20)18(2)30-24(26)22(28-3)19-13-9-7-10-14-19/h7-16,18,21-23H,5-6,17H2,1-4H3/t18-,21+,22+,23+/m0/s1 |
| InChIKey | LBKCQZCZTKHYKS-JBJBFBLISA-N |
| XLogP | 4.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate?
The IUPAC name of [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate (CID 11418945) is [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate.
What is the SMILES notation for [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate?
The canonical SMILES for [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate is CCCC[C@@H](OC(=O)[C@H](OC)c1ccccc1)[C@H](C)OC(=O)[C@H](OC)c1ccccc1.
What is the InChIKey of [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate?
The InChIKey is LBKCQZCZTKHYKS-JBJBFBLISA-N. The full InChI is InChI=1S/C25H32O6/c1-5-6-17-21(31-25(27)23(29-4)20-15-11-8-12-16-20)18(2)30-24(26)22(28-3)19-13-9-7-10-14-19/h7-16,18,21-23H,5-6,17H2,1-4H3/t18-,21+,22+,23+/m0/s1.
What are the key properties of [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate?
[(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate has a molecular weight of 428.53 g/mol, XLogP of 4.80, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-3-[(2R)-2-methoxy-2-phenylacetyl]oxyheptan-2-yl] (2R)-2-methoxy-2-phenylacetate is sourced from PubChem (CID 11418945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).