C17H24O4 — CID 11652238
[(3S,4S)-4-methyl-5-oxoheptan-3-yl] (2S)-2-methoxy-2-phenylacetate (PubChem CID 11652238) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(3S,4S)-4-methyl-5-oxoheptan-3-yl] (2S)-2-methoxy-2-phenylacetate.
| Compound Name | [(3S,4S)-4-methyl-5-oxoheptan-3-yl] (2S)-2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 11652238 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(3S,4S)-4-methyl-5-oxoheptan-3-yl] (2S)-2-methoxy-2-phenylacetate |
| SMILES | CCC(=O)[C@@H](C)[C@H](CC)OC(=O)[C@@H](OC)c1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-5-14(18)12(3)15(6-2)21-17(19)16(20-4)13-10-8-7-9-11-13/h7-12,15-16H,5-6H2,1-4H3/t12-,15+,16+/m1/s1 |
| InChIKey | AWQBAHOAPTVEKE-KCXAZCMYSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |