C41H40O6 — CID 11456370
[(2R,3S)-3-[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxyheptan-2-yl] (2S)-2-anthracen-9-yl-2-methoxyacetate (PubChem CID 11456370) has the molecular formula C41H40O6 and a molecular weight of 628.77 g/mol. Its IUPAC name is [(2R,3S)-3-[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxyheptan-2-yl] (2S)-2-anthracen-9-yl-2-methoxyacetate.
| Compound Name | [(2R,3S)-3-[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxyheptan-2-yl] (2S)-2-anthracen-9-yl-2-methoxyacetate |
|---|---|
| PubChem CID | 11456370 |
| Molecular Formula | C41H40O6 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | [(2R,3S)-3-[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxyheptan-2-yl] (2S)-2-anthracen-9-yl-2-methoxyacetate |
| SMILES | CCCC[C@H](OC(=O)[C@@H](OC)c1c2ccccc2cc2ccccc12)[C@@H](C)OC(=O)[C@@H](OC)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C41H40O6/c1-5-6-23-35(47-41(43)39(45-4)37-33-21-13-9-17-29(33)25-30-18-10-14-22-34(30)37)26(2)46-40(42)38(44-3)36-31-19-11-7-15-27(31)24-28-16-8-12-20-32(28)36/h7-22,24-26,35,38-39H,5-6,23H2,1-4H3/t26-,35+,38+,39+/m1/s1 |
| InChIKey | XGOQNBILFPJOHH-KVTUCSHLSA-N |
| XLogP | 9.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|