C37H32O6 — CID 102172592
[(2S)-2-[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxypropyl] (2S)-2-anthracen-9-yl-2-methoxyacetate (PubChem CID 102172592) has the molecular formula C37H32O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxypropyl] (2S)-2-anthracen-9-yl-2-methoxyacetate.
| Compound Name | [(2S)-2-[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxypropyl] (2S)-2-anthracen-9-yl-2-methoxyacetate |
|---|---|
| PubChem CID | 102172592 |
| Molecular Formula | C37H32O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | [(2S)-2-[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxypropyl] (2S)-2-anthracen-9-yl-2-methoxyacetate |
| SMILES | CO[C@H](C(=O)OC[C@H](C)OC(=O)[C@@H](OC)c1c2ccccc2cc2ccccc12)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C37H32O6/c1-23(43-37(39)35(41-3)33-30-18-10-6-14-26(30)21-27-15-7-11-19-31(27)33)22-42-36(38)34(40-2)32-28-16-8-4-12-24(28)20-25-13-5-9-17-29(25)32/h4-21,23,34-35H,22H2,1-3H3/t23-,34-,35-/m0/s1 |
| InChIKey | BRAVKEBJMRMELG-IEUMEBRQSA-N |
| XLogP | 7.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|