C44H36O8 — CID 11319978
methyl (2S,3S)-2,3-bis[[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxy]-3-phenylpropanoate (PubChem CID 11319978) has the molecular formula C44H36O8 and a molecular weight of 692.76 g/mol. Its IUPAC name is methyl (2S,3S)-2,3-bis[[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxy]-3-phenylpropanoate.
| Compound Name | methyl (2S,3S)-2,3-bis[[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11319978 |
| Molecular Formula | C44H36O8 |
| Molecular Weight | 692.76 g/mol |
| Exact Mass | 692.24 |
| IUPAC Name | methyl (2S,3S)-2,3-bis[[(2S)-2-anthracen-9-yl-2-methoxyacetyl]oxy]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](OC(=O)[C@@H](OC)c1c2ccccc2cc2ccccc12)[C@@H](OC(=O)[C@@H](OC)c1c2ccccc2cc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C44H36O8/c1-48-39(36-32-21-11-7-17-28(32)25-29-18-8-12-22-33(29)36)43(46)51-38(27-15-5-4-6-16-27)41(42(45)50-3)52-44(47)40(49-2)37-34-23-13-9-19-30(34)26-31-20-10-14-24-35(31)37/h4-26,38-41H,1-3H3/t38-,39-,40-,41-/m0/s1 |
| InChIKey | VMUHUHWWICKCQD-MFDNGWNGSA-N |
| XLogP | 8.74 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.76 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|