C21H22O2S — CID 102335411
S-[(2S)-butan-2-yl] (2R)-2-anthracen-9-yl-2-methoxyethanethioate (PubChem CID 102335411) has the molecular formula C21H22O2S and a molecular weight of 338.47 g/mol. Its IUPAC name is S-[(2S)-butan-2-yl] (2R)-2-anthracen-9-yl-2-methoxyethanethioate.
| Compound Name | S-[(2S)-butan-2-yl] (2R)-2-anthracen-9-yl-2-methoxyethanethioate |
|---|---|
| PubChem CID | 102335411 |
| Molecular Formula | C21H22O2S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | S-[(2S)-butan-2-yl] (2R)-2-anthracen-9-yl-2-methoxyethanethioate |
| SMILES | CC[C@H](C)SC(=O)[C@H](OC)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C21H22O2S/c1-4-14(2)24-21(22)20(23-3)19-17-11-7-5-9-15(17)13-16-10-6-8-12-18(16)19/h5-14,20H,4H2,1-3H3/t14-,20+/m0/s1 |
| InChIKey | HRZKWXBLJXKDJZ-VBKZILBWSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|