C42H38O10 — CID 11274007
diethyl (2S,3S)-2,3-bis[[(2R)-2-anthracen-9-yl-2-methoxyacetyl]oxy]butanedioate (PubChem CID 11274007) has the molecular formula C42H38O10 and a molecular weight of 702.76 g/mol. Its IUPAC name is diethyl (2S,3S)-2,3-bis[[(2R)-2-anthracen-9-yl-2-methoxyacetyl]oxy]butanedioate.
| Compound Name | diethyl (2S,3S)-2,3-bis[[(2R)-2-anthracen-9-yl-2-methoxyacetyl]oxy]butanedioate |
|---|---|
| PubChem CID | 11274007 |
| Molecular Formula | C42H38O10 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.25 |
| IUPAC Name | diethyl (2S,3S)-2,3-bis[[(2R)-2-anthracen-9-yl-2-methoxyacetyl]oxy]butanedioate |
| SMILES | CCOC(=O)[C@@H](OC(=O)[C@H](OC)c1c2ccccc2cc2ccccc12)[C@H](OC(=O)[C@H](OC)c1c2ccccc2cc2ccccc12)C(=O)OCC |
| InChI | InChI=1S/C42H38O10/c1-5-49-39(43)37(51-41(45)35(47-3)33-29-19-11-7-15-25(29)23-26-16-8-12-20-30(26)33)38(40(44)50-6-2)52-42(46)36(48-4)34-31-21-13-9-17-27(31)24-28-18-10-14-22-32(28)34/h7-24,35-38H,5-6H2,1-4H3/t35-,36-,37+,38+/m1/s1 |
| InChIKey | BFEAUIRXIKFDOB-RNATXAOGSA-N |
| XLogP | 7.32 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|