C27H26O6 — CID 101061273
2-O-[(1S)-1-anthracen-9-yl-2-ethoxy-2-oxoethyl] 1-O-methyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 101061273) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-O-[(1S)-1-anthracen-9-yl-2-ethoxy-2-oxoethyl] 1-O-methyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 2-O-[(1S)-1-anthracen-9-yl-2-ethoxy-2-oxoethyl] 1-O-methyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101061273 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-O-[(1S)-1-anthracen-9-yl-2-ethoxy-2-oxoethyl] 1-O-methyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H](OC(=O)[C@@H]1CC=CC[C@@H]1C(=O)OC)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C27H26O6/c1-3-32-27(30)24(33-26(29)22-15-9-8-14-21(22)25(28)31-2)23-19-12-6-4-10-17(19)16-18-11-5-7-13-20(18)23/h4-13,16,21-22,24H,3,14-15H2,1-2H3/t21-,22+,24-/m0/s1 |
| InChIKey | LGQIWXYXCAYTEA-ZDXQCDESSA-N |
| XLogP | 4.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|