C26H23NO4 — CID 102234773
ethyl (2S)-2-anthracen-9-yl-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 102234773) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is ethyl (2S)-2-anthracen-9-yl-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | ethyl (2S)-2-anthracen-9-yl-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 102234773 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | ethyl (2S)-2-anthracen-9-yl-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | CCOC(=O)[C@@H](NC(=O)OCc1ccccc1)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C26H23NO4/c1-2-30-25(28)24(27-26(29)31-17-18-10-4-3-5-11-18)23-21-14-8-6-12-19(21)16-20-13-7-9-15-22(20)23/h3-16,24H,2,17H2,1H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | QECFPMSFCIMHCQ-DEOSSOPVSA-N |
| XLogP | 5.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|