C28H28NO5P — CID 134929549
benzyl N-[anthracen-9-yl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]carbamate (PubChem CID 134929549) has the molecular formula C28H28NO5P and a molecular weight of 489.51 g/mol. Its IUPAC name is benzyl N-[anthracen-9-yl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]carbamate.
| Compound Name | benzyl N-[anthracen-9-yl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 134929549 |
| Molecular Formula | C28H28NO5P |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | benzyl N-[anthracen-9-yl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]carbamate |
| SMILES | CC1(C)COP(=O)(C(NC(=O)OCc2ccccc2)c2c3ccccc3cc3ccccc23)OC1 |
| InChI | InChI=1S/C28H28NO5P/c1-28(2)18-33-35(31,34-19-28)26(29-27(30)32-17-20-10-4-3-5-11-20)25-23-14-8-6-12-21(23)16-22-13-7-9-15-24(22)25/h3-16,26H,17-19H2,1-2H3,(H,29,30) |
| InChIKey | BHRFJZOREPEVFJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|