C22H25NO5 — CID 25193791
(3-methyloxetan-3-yl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 25193791) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (3-methyloxetan-3-yl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 25193791 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (3-methyloxetan-3-yl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC1(COC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)COC1 |
| InChI | InChI=1S/C22H25NO5/c1-22(14-26-15-22)16-28-20(24)19(12-17-8-4-2-5-9-17)23-21(25)27-13-18-10-6-3-7-11-18/h2-11,19H,12-16H2,1H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | CUFASLRYCNDDSR-IBGZPJMESA-N |
| XLogP | 3.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |