C19H27NO5 — CID 118184137
ethyl (5R)-2,6-dimethyl-4-oxo-5-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 118184137) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl (5R)-2,6-dimethyl-4-oxo-5-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | ethyl (5R)-2,6-dimethyl-4-oxo-5-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 118184137 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | ethyl (5R)-2,6-dimethyl-4-oxo-5-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | CCOC(=O)C(C)CC(=O)[C@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C19H27NO5/c1-5-24-18(22)14(4)11-16(21)17(13(2)3)20-19(23)25-12-15-9-7-6-8-10-15/h6-10,13-14,17H,5,11-12H2,1-4H3,(H,20,23)/t14?,17-/m1/s1 |
| InChIKey | YVCNNXOZAYDTGB-FBMWCMRBSA-N |
| XLogP | 3.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |