C18H22O3 — CID 102533727
[(2S)-pentan-2-yl] (2R)-2-methoxy-2-naphthalen-1-ylacetate (PubChem CID 102533727) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(2S)-pentan-2-yl] (2R)-2-methoxy-2-naphthalen-1-ylacetate.
| Compound Name | [(2S)-pentan-2-yl] (2R)-2-methoxy-2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 102533727 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(2S)-pentan-2-yl] (2R)-2-methoxy-2-naphthalen-1-ylacetate |
| SMILES | CCC[C@H](C)OC(=O)[C@H](OC)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H22O3/c1-4-8-13(2)21-18(19)17(20-3)16-12-7-10-14-9-5-6-11-15(14)16/h5-7,9-13,17H,4,8H2,1-3H3/t13-,17+/m0/s1 |
| InChIKey | NACWPZQXAWSRPU-SUMWQHHRSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |