About [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate
[(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate (PubChem CID 102533735) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate.
Molecular Properties
| Compound Name | [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate |
| PubChem CID | 102533735 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate |
| SMILES | CCC[C@H](CC)OC(=O)[C@@H](OC)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H24O3/c1-4-9-15(5-2)22-19(20)18(21-3)17-13-8-11-14-10-6-7-12-16(14)17/h6-8,10-13,15,18H,4-5,9H2,1-3H3/t15-,18-/m0/s1 |
| InChIKey | XBPOZMXRNREEDT-YJBOKZPZSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate?
The IUPAC name of [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate (CID 102533735) is [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate.
What is the SMILES notation for [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate?
The canonical SMILES for [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate is CCC[C@H](CC)OC(=O)[C@@H](OC)c1cccc2ccccc12.
What is the InChIKey of [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate?
The InChIKey is XBPOZMXRNREEDT-YJBOKZPZSA-N. The full InChI is InChI=1S/C19H24O3/c1-4-9-15(5-2)22-19(20)18(21-3)17-13-8-11-14-10-6-7-12-16(14)17/h6-8,10-13,15,18H,4-5,9H2,1-3H3/t15-,18-/m0/s1.
What are the key properties of [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate?
[(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate has a molecular weight of 300.40 g/mol, XLogP of 4.65, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate is sourced from PubChem (CID 102533735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).