C19H24O3 — CID 102533735
[(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate (PubChem CID 102533735) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate.
| Compound Name | [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 102533735 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [(3S)-hexan-3-yl] (2S)-2-methoxy-2-naphthalen-1-ylacetate |
| SMILES | CCC[C@H](CC)OC(=O)[C@@H](OC)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H24O3/c1-4-9-15(5-2)22-19(20)18(21-3)17-13-8-11-14-10-6-7-12-16(14)17/h6-8,10-13,15,18H,4-5,9H2,1-3H3/t15-,18-/m0/s1 |
| InChIKey | XBPOZMXRNREEDT-YJBOKZPZSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |