About [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate
[(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate (PubChem CID 24796642) has the molecular formula C24H34O3
and a molecular weight of 370.53 g/mol. Its IUPAC name is [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate.
Molecular Properties
| Compound Name | [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate |
| PubChem CID | 24796642 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate |
| SMILES | CCCCCCC[C@H](C)CCOC(=O)[C@@H](OC)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H34O3/c1-4-5-6-7-8-12-19(2)17-18-27-24(25)23(26-3)22-16-11-14-20-13-9-10-15-21(20)22/h9-11,13-16,19,23H,4-8,12,17-18H2,1-3H3/t19-,23-/m0/s1 |
| InChIKey | ZNPZOKJXFIGMNL-CVDCTZTESA-N |
| XLogP | 6.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate?
The IUPAC name of [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate (CID 24796642) is [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate.
What is the SMILES notation for [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate?
The canonical SMILES for [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate is CCCCCCC[C@H](C)CCOC(=O)[C@@H](OC)c1cccc2ccccc12.
What is the InChIKey of [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate?
The InChIKey is ZNPZOKJXFIGMNL-CVDCTZTESA-N. The full InChI is InChI=1S/C24H34O3/c1-4-5-6-7-8-12-19(2)17-18-27-24(25)23(26-3)22-16-11-14-20-13-9-10-15-21(20)22/h9-11,13-16,19,23H,4-8,12,17-18H2,1-3H3/t19-,23-/m0/s1.
What are the key properties of [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate?
[(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate has a molecular weight of 370.53 g/mol, XLogP of 6.46, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-methyldecyl] (2S)-2-methoxy-2-naphthalen-1-ylacetate is sourced from PubChem (CID 24796642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).