About butan-2-one;N-methyl-2-phenylhexanamide
butan-2-one;N-methyl-2-phenylhexanamide (PubChem CID 143353676) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is butan-2-one;N-methyl-2-phenylhexanamide.
Molecular Properties
| Compound Name | butan-2-one;N-methyl-2-phenylhexanamide |
| PubChem CID | 143353676 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | butan-2-one;N-methyl-2-phenylhexanamide |
| SMILES | CCC(C)=O.CCCCC(C(=O)NC)c1ccccc1 |
| InChI | InChI=1S/C13H19NO.C4H8O/c1-3-4-10-12(13(15)14-2)11-8-6-5-7-9-11;1-3-4(2)5/h5-9,12H,3-4,10H2,1-2H3,(H,14,15);3H2,1-2H3 |
| InChIKey | HVTODGLMEQUQHD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;N-methyl-2-phenylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;N-methyl-2-phenylhexanamide?
The IUPAC name of butan-2-one;N-methyl-2-phenylhexanamide (CID 143353676) is butan-2-one;N-methyl-2-phenylhexanamide.
What is the SMILES notation for butan-2-one;N-methyl-2-phenylhexanamide?
The canonical SMILES for butan-2-one;N-methyl-2-phenylhexanamide is CCC(C)=O.CCCCC(C(=O)NC)c1ccccc1.
What is the InChIKey of butan-2-one;N-methyl-2-phenylhexanamide?
The InChIKey is HVTODGLMEQUQHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO.C4H8O/c1-3-4-10-12(13(15)14-2)11-8-6-5-7-9-11;1-3-4(2)5/h5-9,12H,3-4,10H2,1-2H3,(H,14,15);3H2,1-2H3.
What are the key properties of butan-2-one;N-methyl-2-phenylhexanamide?
butan-2-one;N-methyl-2-phenylhexanamide has a molecular weight of 277.41 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;N-methyl-2-phenylhexanamide is sourced from PubChem (CID 143353676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).