About ethane;(3S)-3-phenyloctan-2-one;propane
ethane;(3S)-3-phenyloctan-2-one;propane (PubChem CID 143356286) has the molecular formula C19H34O
and a molecular weight of 278.48 g/mol. Its IUPAC name is ethane;(3S)-3-phenyloctan-2-one;propane.
Molecular Properties
| Compound Name | ethane;(3S)-3-phenyloctan-2-one;propane |
| PubChem CID | 143356286 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | ethane;(3S)-3-phenyloctan-2-one;propane |
| SMILES | CC.CCC.CCCCC[C@H](C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C14H20O.C3H8.C2H6/c1-3-4-6-11-14(12(2)15)13-9-7-5-8-10-13;1-3-2;1-2/h5,7-10,14H,3-4,6,11H2,1-2H3;3H2,1-2H3;1-2H3/t14-;;/m1../s1 |
| InChIKey | ISBNFYIBDRQQCJ-FMOMHUKBSA-N |
| XLogP | 6.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3S)-3-phenyloctan-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3S)-3-phenyloctan-2-one;propane?
The IUPAC name of ethane;(3S)-3-phenyloctan-2-one;propane (CID 143356286) is ethane;(3S)-3-phenyloctan-2-one;propane.
What is the SMILES notation for ethane;(3S)-3-phenyloctan-2-one;propane?
The canonical SMILES for ethane;(3S)-3-phenyloctan-2-one;propane is CC.CCC.CCCCC[C@H](C(C)=O)c1ccccc1.
What is the InChIKey of ethane;(3S)-3-phenyloctan-2-one;propane?
The InChIKey is ISBNFYIBDRQQCJ-FMOMHUKBSA-N. The full InChI is InChI=1S/C14H20O.C3H8.C2H6/c1-3-4-6-11-14(12(2)15)13-9-7-5-8-10-13;1-3-2;1-2/h5,7-10,14H,3-4,6,11H2,1-2H3;3H2,1-2H3;1-2H3/t14-;;/m1../s1.
What are the key properties of ethane;(3S)-3-phenyloctan-2-one;propane?
ethane;(3S)-3-phenyloctan-2-one;propane has a molecular weight of 278.48 g/mol, XLogP of 6.38, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3S)-3-phenyloctan-2-one;propane is sourced from PubChem (CID 143356286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).