About ethane;pentan-2-one;2-phenylhexanamide
ethane;pentan-2-one;2-phenylhexanamide (PubChem CID 143363215) has the molecular formula C19H33NO2
and a molecular weight of 307.48 g/mol. Its IUPAC name is ethane;pentan-2-one;2-phenylhexanamide.
Molecular Properties
| Compound Name | ethane;pentan-2-one;2-phenylhexanamide |
| PubChem CID | 143363215 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | ethane;pentan-2-one;2-phenylhexanamide |
| SMILES | CC.CCCC(C)=O.CCCCC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO.C5H10O.C2H6/c1-2-3-9-11(12(13)14)10-7-5-4-6-8-10;1-3-4-5(2)6;1-2/h4-8,11H,2-3,9H2,1H3,(H2,13,14);3-4H2,1-2H3;1-2H3 |
| InChIKey | VORBZHNNDGCOJD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;pentan-2-one;2-phenylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pentan-2-one;2-phenylhexanamide?
The IUPAC name of ethane;pentan-2-one;2-phenylhexanamide (CID 143363215) is ethane;pentan-2-one;2-phenylhexanamide.
What is the SMILES notation for ethane;pentan-2-one;2-phenylhexanamide?
The canonical SMILES for ethane;pentan-2-one;2-phenylhexanamide is CC.CCCC(C)=O.CCCCC(C(N)=O)c1ccccc1.
What is the InChIKey of ethane;pentan-2-one;2-phenylhexanamide?
The InChIKey is VORBZHNNDGCOJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO.C5H10O.C2H6/c1-2-3-9-11(12(13)14)10-7-5-4-6-8-10;1-3-4-5(2)6;1-2/h4-8,11H,2-3,9H2,1H3,(H2,13,14);3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;pentan-2-one;2-phenylhexanamide?
ethane;pentan-2-one;2-phenylhexanamide has a molecular weight of 307.48 g/mol, XLogP of 4.85, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pentan-2-one;2-phenylhexanamide is sourced from PubChem (CID 143363215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).