About 3-phenylheptanamide
3-phenylheptanamide (PubChem CID 91447364) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-phenylheptanamide.
Molecular Properties
| Compound Name | 3-phenylheptanamide |
| PubChem CID | 91447364 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-phenylheptanamide |
| SMILES | CCCCC(CC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-2-3-7-12(10-13(14)15)11-8-5-4-6-9-11/h4-6,8-9,12H,2-3,7,10H2,1H3,(H2,14,15) |
| InChIKey | AEWYUPXCHHLSSO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylheptanamide?
The IUPAC name of 3-phenylheptanamide (CID 91447364) is 3-phenylheptanamide.
What is the SMILES notation for 3-phenylheptanamide?
The canonical SMILES for 3-phenylheptanamide is CCCCC(CC(N)=O)c1ccccc1.
What is the InChIKey of 3-phenylheptanamide?
The InChIKey is AEWYUPXCHHLSSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-2-3-7-12(10-13(14)15)11-8-5-4-6-9-11/h4-6,8-9,12H,2-3,7,10H2,1H3,(H2,14,15).
What are the key properties of 3-phenylheptanamide?
3-phenylheptanamide has a molecular weight of 205.30 g/mol, XLogP of 2.84, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylheptanamide is sourced from PubChem (CID 91447364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).