C19H32N2O2 — CID 110185926
2-methylbutan-2-yl 2-[2-(diethylamino)ethylamino]-2-phenylacetate (PubChem CID 110185926) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 2-methylbutan-2-yl 2-[2-(diethylamino)ethylamino]-2-phenylacetate.
| Compound Name | 2-methylbutan-2-yl 2-[2-(diethylamino)ethylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 110185926 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 2-methylbutan-2-yl 2-[2-(diethylamino)ethylamino]-2-phenylacetate |
| SMILES | CCN(CC)CCNC(C(=O)OC(C)(C)CC)c1ccccc1 |
| InChI | InChI=1S/C19H32N2O2/c1-6-19(4,5)23-18(22)17(16-12-10-9-11-13-16)20-14-15-21(7-2)8-3/h9-13,17,20H,6-8,14-15H2,1-5H3 |
| InChIKey | YMYNJJBMMXTGFJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |