C20H31F3N2O2 — CID 110185867
3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-[4-(trifluoromethyl)phenyl]acetate (PubChem CID 110185867) has the molecular formula C20H31F3N2O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-[4-(trifluoromethyl)phenyl]acetate.
| Compound Name | 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-[4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 110185867 |
| Molecular Formula | C20H31F3N2O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-[4-(trifluoromethyl)phenyl]acetate |
| SMILES | CCN(CC)CCNC(C(=O)OCCC(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H31F3N2O2/c1-5-25(6-2)13-12-24-18(19(26)27-14-11-15(3)4)16-7-9-17(10-8-16)20(21,22)23/h7-10,15,18,24H,5-6,11-14H2,1-4H3 |
| InChIKey | ABUBDBAXRPDXQT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |